C20H20Cl2N2O4 — CID 93322542
(3S)-4-(3,4-dichlorobenzoyl)-1-(3,5-dimethoxyphenyl)-3-methylpiperazin-2-one (PubChem CID 93322542) has the molecular formula C20H20Cl2N2O4 and a molecular weight of 423.30 g/mol. Its IUPAC name is (3S)-4-(3,4-dichlorobenzoyl)-1-(3,5-dimethoxyphenyl)-3-methylpiperazin-2-one.
| Compound Name | (3S)-4-(3,4-dichlorobenzoyl)-1-(3,5-dimethoxyphenyl)-3-methylpiperazin-2-one |
|---|---|
| PubChem CID | 93322542 |
| Molecular Formula | C20H20Cl2N2O4 |
| Molecular Weight | 423.30 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | (3S)-4-(3,4-dichlorobenzoyl)-1-(3,5-dimethoxyphenyl)-3-methylpiperazin-2-one |
| SMILES | COc1cc(OC)cc(N2CCN(C(=O)c3ccc(Cl)c(Cl)c3)[C@@H](C)C2=O)c1 |
| InChI | InChI=1S/C20H20Cl2N2O4/c1-12-19(25)24(14-9-15(27-2)11-16(10-14)28-3)7-6-23(12)20(26)13-4-5-17(21)18(22)8-13/h4-5,8-12H,6-7H2,1-3H3/t12-/m0/s1 |
| InChIKey | MEACRWUGVBAPHW-LBPRGKRZSA-N |
| XLogP | 3.89 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.30 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |