C18H15Cl2FN2O2 — CID 93322535
(3R)-4-(3,4-dichlorobenzoyl)-1-(4-fluorophenyl)-3-methylpiperazin-2-one (PubChem CID 93322535) has the molecular formula C18H15Cl2FN2O2 and a molecular weight of 381.23 g/mol. Its IUPAC name is (3R)-4-(3,4-dichlorobenzoyl)-1-(4-fluorophenyl)-3-methylpiperazin-2-one.
| Compound Name | (3R)-4-(3,4-dichlorobenzoyl)-1-(4-fluorophenyl)-3-methylpiperazin-2-one |
|---|---|
| PubChem CID | 93322535 |
| Molecular Formula | C18H15Cl2FN2O2 |
| Molecular Weight | 381.23 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | (3R)-4-(3,4-dichlorobenzoyl)-1-(4-fluorophenyl)-3-methylpiperazin-2-one |
| SMILES | C[C@@H]1C(=O)N(c2ccc(F)cc2)CCN1C(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H15Cl2FN2O2/c1-11-17(24)23(14-5-3-13(21)4-6-14)9-8-22(11)18(25)12-2-7-15(19)16(20)10-12/h2-7,10-11H,8-9H2,1H3/t11-/m1/s1 |
| InChIKey | XJNHSEJAFUFQQD-LLVKDONJSA-N |
| XLogP | 4.01 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.23 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |