C21H24N2O4 — CID 93321791
(3S)-1-(3,5-dimethoxyphenyl)-3-methyl-4-(4-methylbenzoyl)piperazin-2-one (PubChem CID 93321791) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is (3S)-1-(3,5-dimethoxyphenyl)-3-methyl-4-(4-methylbenzoyl)piperazin-2-one.
| Compound Name | (3S)-1-(3,5-dimethoxyphenyl)-3-methyl-4-(4-methylbenzoyl)piperazin-2-one |
|---|---|
| PubChem CID | 93321791 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | (3S)-1-(3,5-dimethoxyphenyl)-3-methyl-4-(4-methylbenzoyl)piperazin-2-one |
| SMILES | COc1cc(OC)cc(N2CCN(C(=O)c3ccc(C)cc3)[C@@H](C)C2=O)c1 |
| InChI | InChI=1S/C21H24N2O4/c1-14-5-7-16(8-6-14)21(25)22-9-10-23(20(24)15(22)2)17-11-18(26-3)13-19(12-17)27-4/h5-8,11-13,15H,9-10H2,1-4H3/t15-/m0/s1 |
| InChIKey | UESXAGSWZLJAQT-HNNXBMFYSA-N |
| XLogP | 2.89 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |