C20H20Cl2N2O2 — CID 93322771
(3R)-4-(2,4-dichlorobenzoyl)-1-(3,5-dimethylphenyl)-3-methylpiperazin-2-one (PubChem CID 93322771) has the molecular formula C20H20Cl2N2O2 and a molecular weight of 391.30 g/mol. Its IUPAC name is (3R)-4-(2,4-dichlorobenzoyl)-1-(3,5-dimethylphenyl)-3-methylpiperazin-2-one.
| Compound Name | (3R)-4-(2,4-dichlorobenzoyl)-1-(3,5-dimethylphenyl)-3-methylpiperazin-2-one |
|---|---|
| PubChem CID | 93322771 |
| Molecular Formula | C20H20Cl2N2O2 |
| Molecular Weight | 391.30 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | (3R)-4-(2,4-dichlorobenzoyl)-1-(3,5-dimethylphenyl)-3-methylpiperazin-2-one |
| SMILES | Cc1cc(C)cc(N2CCN(C(=O)c3ccc(Cl)cc3Cl)[C@H](C)C2=O)c1 |
| InChI | InChI=1S/C20H20Cl2N2O2/c1-12-8-13(2)10-16(9-12)24-7-6-23(14(3)19(24)25)20(26)17-5-4-15(21)11-18(17)22/h4-5,8-11,14H,6-7H2,1-3H3/t14-/m1/s1 |
| InChIKey | CMBKNTGRNGSDNY-CQSZACIVSA-N |
| XLogP | 4.49 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.30 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |