C20H21FN2O4 — CID 24719545
1-(3,4-dimethoxyphenyl)-4-(3-fluorobenzoyl)-3-methylpiperazin-2-one (PubChem CID 24719545) has the molecular formula C20H21FN2O4 and a molecular weight of 372.40 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-4-(3-fluorobenzoyl)-3-methylpiperazin-2-one.
| Compound Name | 1-(3,4-dimethoxyphenyl)-4-(3-fluorobenzoyl)-3-methylpiperazin-2-one |
|---|---|
| PubChem CID | 24719545 |
| Molecular Formula | C20H21FN2O4 |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-4-(3-fluorobenzoyl)-3-methylpiperazin-2-one |
| SMILES | COc1ccc(N2CCN(C(=O)c3cccc(F)c3)C(C)C2=O)cc1OC |
| InChI | InChI=1S/C20H21FN2O4/c1-13-19(24)23(16-7-8-17(26-2)18(12-16)27-3)10-9-22(13)20(25)14-5-4-6-15(21)11-14/h4-8,11-13H,9-10H2,1-3H3 |
| InChIKey | WEZWYRFETWPWQV-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |