C20H24N6O3 — CID 22856613
methyl 2-[(3S,5S)-5-[[[5-(4-carbamimidoylphenyl)pyrazin-2-yl]-methylamino]methyl]-2-oxopyrrolidin-3-yl]acetate (PubChem CID 22856613) has the molecular formula C20H24N6O3 and a molecular weight of 396.45 g/mol. Its IUPAC name is methyl 2-[(3S,5S)-5-[[[5-(4-carbamimidoylphenyl)pyrazin-2-yl]-methylamino]methyl]-2-oxopyrrolidin-3-yl]acetate.
| Compound Name | methyl 2-[(3S,5S)-5-[[[5-(4-carbamimidoylphenyl)pyrazin-2-yl]-methylamino]methyl]-2-oxopyrrolidin-3-yl]acetate |
|---|---|
| PubChem CID | 22856613 |
| Molecular Formula | C20H24N6O3 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | methyl 2-[(3S,5S)-5-[[[5-(4-carbamimidoylphenyl)pyrazin-2-yl]-methylamino]methyl]-2-oxopyrrolidin-3-yl]acetate |
| SMILES | [H]/N=C(\N)c1ccc(-c2cnc(N(C)C[C@@H]3C[C@@H](CC(=O)OC)C(=O)N3)cn2)cc1 |
| InChI | InChI=1S/C20H24N6O3/c1-26(11-15-7-14(20(28)25-15)8-18(27)29-2)17-10-23-16(9-24-17)12-3-5-13(6-4-12)19(21)22/h3-6,9-10,14-15H,7-8,11H2,1-2H3,(H3,21,22)(H,25,28)/t14-,15-/m0/s1 |
| InChIKey | XZFHSKNGWOAURY-GJZGRUSLSA-N |
| XLogP | 0.93 |
| TPSA | 134.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|