C23H33ClN4O3 — CID 22863961
methyl 2-[(3S,5S)-5-[[[(3aS,6aR)-5-(4-carbamimidoylphenyl)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]amino]methyl]-2-oxopyrrolidin-3-yl]acetate;hydrochloride (PubChem CID 22863961) has the molecular formula C23H33ClN4O3 and a molecular weight of 449.00 g/mol. Its IUPAC name is methyl 2-[(3S,5S)-5-[[[(3aS,6aR)-5-(4-carbamimidoylphenyl)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]amino]methyl]-2-oxopyrrolidin-3-yl]acetate;hydrochloride.
| Compound Name | methyl 2-[(3S,5S)-5-[[[(3aS,6aR)-5-(4-carbamimidoylphenyl)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]amino]methyl]-2-oxopyrrolidin-3-yl]acetate;hydrochloride |
|---|---|
| PubChem CID | 22863961 |
| Molecular Formula | C23H33ClN4O3 |
| Molecular Weight | 449.00 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | methyl 2-[(3S,5S)-5-[[[(3aS,6aR)-5-(4-carbamimidoylphenyl)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]amino]methyl]-2-oxopyrrolidin-3-yl]acetate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(C2C[C@H]3CC(NC[C@@H]4C[C@@H](CC(=O)OC)C(=O)N4)C[C@H]3C2)cc1 |
| InChI | InChI=1S/C23H32N4O3.ClH/c1-30-21(28)11-18-10-20(27-23(18)29)12-26-19-8-16-6-15(7-17(16)9-19)13-2-4-14(5-3-13)22(24)25;/h2-5,15-20,26H,6-12H2,1H3,(H3,24,25)(H,27,29);1H/t15?,16-,17+,18-,19?,20-;/m0./s1 |
| InChIKey | LGGXLYNQLHGXFJ-UIBZWPBYSA-N |
| XLogP | 2.32 |
| TPSA | 117.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.00 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|