C22H34ClN5O4 — CID 22444759
methyl 4-[4-(4-carbamimidoylphenyl)piperazin-1-yl]-1-(2-ethoxy-2-oxoethyl)piperidine-3-carboxylate;hydrochloride (PubChem CID 22444759) has the molecular formula C22H34ClN5O4 and a molecular weight of 468.00 g/mol. Its IUPAC name is methyl 4-[4-(4-carbamimidoylphenyl)piperazin-1-yl]-1-(2-ethoxy-2-oxoethyl)piperidine-3-carboxylate;hydrochloride.
| Compound Name | methyl 4-[4-(4-carbamimidoylphenyl)piperazin-1-yl]-1-(2-ethoxy-2-oxoethyl)piperidine-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 22444759 |
| Molecular Formula | C22H34ClN5O4 |
| Molecular Weight | 468.00 g/mol |
| Exact Mass | 467.23 |
| IUPAC Name | methyl 4-[4-(4-carbamimidoylphenyl)piperazin-1-yl]-1-(2-ethoxy-2-oxoethyl)piperidine-3-carboxylate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(N2CCN(C3CCN(CC(=O)OCC)CC3C(=O)OC)CC2)cc1 |
| InChI | InChI=1S/C22H33N5O4.ClH/c1-3-31-20(28)15-25-9-8-19(18(14-25)22(29)30-2)27-12-10-26(11-13-27)17-6-4-16(5-7-17)21(23)24;/h4-7,18-19H,3,8-15H2,1-2H3,(H3,23,24);1H |
| InChIKey | VNVZVTPCDXYJAO-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.00 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|