C28H40ClN5O4S — CID 139707149
ethyl 2-[3-[2-(benzenesulfonyl)ethyl]-4-[4-(4-carbamimidoylphenyl)piperazin-1-yl]piperidin-1-yl]acetate;hydrochloride (PubChem CID 139707149) has the molecular formula C28H40ClN5O4S and a molecular weight of 578.18 g/mol. Its IUPAC name is ethyl 2-[3-[2-(benzenesulfonyl)ethyl]-4-[4-(4-carbamimidoylphenyl)piperazin-1-yl]piperidin-1-yl]acetate;hydrochloride.
| Compound Name | ethyl 2-[3-[2-(benzenesulfonyl)ethyl]-4-[4-(4-carbamimidoylphenyl)piperazin-1-yl]piperidin-1-yl]acetate;hydrochloride |
|---|---|
| PubChem CID | 139707149 |
| Molecular Formula | C28H40ClN5O4S |
| Molecular Weight | 578.18 g/mol |
| Exact Mass | 577.25 |
| IUPAC Name | ethyl 2-[3-[2-(benzenesulfonyl)ethyl]-4-[4-(4-carbamimidoylphenyl)piperazin-1-yl]piperidin-1-yl]acetate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(N2CCN(C3CCN(CC(=O)OCC)CC3CCS(=O)(=O)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C28H39N5O4S.ClH/c1-2-37-27(34)21-31-14-12-26(23(20-31)13-19-38(35,36)25-6-4-3-5-7-25)33-17-15-32(16-18-33)24-10-8-22(9-11-24)28(29)30;/h3-11,23,26H,2,12-21H2,1H3,(H3,29,30);1H |
| InChIKey | IZXKOQIUDCKSAV-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.18 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|