C23H31N5O2S — CID 54179796
methyl 2-[4-[4-(4-carbamimidoylphenyl)piperazin-1-yl]piperidin-1-yl]-2-thiophen-3-ylacetate (PubChem CID 54179796) has the molecular formula C23H31N5O2S and a molecular weight of 441.60 g/mol. Its IUPAC name is methyl 2-[4-[4-(4-carbamimidoylphenyl)piperazin-1-yl]piperidin-1-yl]-2-thiophen-3-ylacetate.
| Compound Name | methyl 2-[4-[4-(4-carbamimidoylphenyl)piperazin-1-yl]piperidin-1-yl]-2-thiophen-3-ylacetate |
|---|---|
| PubChem CID | 54179796 |
| Molecular Formula | C23H31N5O2S |
| Molecular Weight | 441.60 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | methyl 2-[4-[4-(4-carbamimidoylphenyl)piperazin-1-yl]piperidin-1-yl]-2-thiophen-3-ylacetate |
| SMILES | [H]/N=C(\N)c1ccc(N2CCN(C3CCN(C(C(=O)OC)c4ccsc4)CC3)CC2)cc1 |
| InChI | InChI=1S/C23H31N5O2S/c1-30-23(29)21(18-8-15-31-16-18)28-9-6-20(7-10-28)27-13-11-26(12-14-27)19-4-2-17(3-5-19)22(24)25/h2-5,8,15-16,20-21H,6-7,9-14H2,1H3,(H3,24,25) |
| InChIKey | PAZXGXXOYJEFJN-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.60 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|