C25H30F3N5O2 — CID 70107858
2-[4-[4-(4-carbamimidoylphenyl)piperazin-1-yl]piperidin-1-yl]-2-[4-(trifluoromethyl)phenyl]acetic acid (PubChem CID 70107858) has the molecular formula C25H30F3N5O2 and a molecular weight of 489.54 g/mol. Its IUPAC name is 2-[4-[4-(4-carbamimidoylphenyl)piperazin-1-yl]piperidin-1-yl]-2-[4-(trifluoromethyl)phenyl]acetic acid.
| Compound Name | 2-[4-[4-(4-carbamimidoylphenyl)piperazin-1-yl]piperidin-1-yl]-2-[4-(trifluoromethyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 70107858 |
| Molecular Formula | C25H30F3N5O2 |
| Molecular Weight | 489.54 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | 2-[4-[4-(4-carbamimidoylphenyl)piperazin-1-yl]piperidin-1-yl]-2-[4-(trifluoromethyl)phenyl]acetic acid |
| SMILES | [H]/N=C(\N)c1ccc(N2CCN(C3CCN(C(C(=O)O)c4ccc(C(F)(F)F)cc4)CC3)CC2)cc1 |
| InChI | InChI=1S/C25H30F3N5O2/c26-25(27,28)19-5-1-17(2-6-19)22(24(34)35)33-11-9-21(10-12-33)32-15-13-31(14-16-32)20-7-3-18(4-8-20)23(29)30/h1-8,21-22H,9-16H2,(H3,29,30)(H,34,35) |
| InChIKey | AWTNDMVQHDKDJC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.54 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|