C22H23F3N4O2 — CID 86969741
4-[4-[2-oxo-1-[4-(trifluoromethyl)phenyl]pyrrolidin-3-yl]piperazin-1-yl]benzamide (PubChem CID 86969741) has the molecular formula C22H23F3N4O2 and a molecular weight of 432.45 g/mol. Its IUPAC name is 4-[4-[2-oxo-1-[4-(trifluoromethyl)phenyl]pyrrolidin-3-yl]piperazin-1-yl]benzamide.
| Compound Name | 4-[4-[2-oxo-1-[4-(trifluoromethyl)phenyl]pyrrolidin-3-yl]piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 86969741 |
| Molecular Formula | C22H23F3N4O2 |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 4-[4-[2-oxo-1-[4-(trifluoromethyl)phenyl]pyrrolidin-3-yl]piperazin-1-yl]benzamide |
| SMILES | NC(=O)c1ccc(N2CCN(C3CCN(c4ccc(C(F)(F)F)cc4)C3=O)CC2)cc1 |
| InChI | InChI=1S/C22H23F3N4O2/c23-22(24,25)16-3-7-18(8-4-16)29-10-9-19(21(29)31)28-13-11-27(12-14-28)17-5-1-15(2-6-17)20(26)30/h1-8,19H,9-14H2,(H2,26,30) |
| InChIKey | TXFSDYAMHUHOPY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 69.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |