C18H26N2O3 — CID 72934020
2-(4-cyclohexylpiperazin-1-yl)-2-(4-hydroxyphenyl)acetic acid (PubChem CID 72934020) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is 2-(4-cyclohexylpiperazin-1-yl)-2-(4-hydroxyphenyl)acetic acid.
| Compound Name | 2-(4-cyclohexylpiperazin-1-yl)-2-(4-hydroxyphenyl)acetic acid |
|---|---|
| PubChem CID | 72934020 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 2-(4-cyclohexylpiperazin-1-yl)-2-(4-hydroxyphenyl)acetic acid |
| SMILES | O=C(O)C(c1ccc(O)cc1)N1CCN(C2CCCCC2)CC1 |
| InChI | InChI=1S/C18H26N2O3/c21-16-8-6-14(7-9-16)17(18(22)23)20-12-10-19(11-13-20)15-4-2-1-3-5-15/h6-9,15,17,21H,1-5,10-13H2,(H,22,23) |
| InChIKey | WRXPKGPBUIZMFA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |