C19H28N2O3 — CID 97203112
(2S)-2-(4-cyclopentylpiperazin-1-yl)-2-(4-methoxy-3-methylphenyl)acetic acid (PubChem CID 97203112) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is (2S)-2-(4-cyclopentylpiperazin-1-yl)-2-(4-methoxy-3-methylphenyl)acetic acid.
| Compound Name | (2S)-2-(4-cyclopentylpiperazin-1-yl)-2-(4-methoxy-3-methylphenyl)acetic acid |
|---|---|
| PubChem CID | 97203112 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | (2S)-2-(4-cyclopentylpiperazin-1-yl)-2-(4-methoxy-3-methylphenyl)acetic acid |
| SMILES | COc1ccc([C@@H](C(=O)O)N2CCN(C3CCCC3)CC2)cc1C |
| InChI | InChI=1S/C19H28N2O3/c1-14-13-15(7-8-17(14)24-2)18(19(22)23)21-11-9-20(10-12-21)16-5-3-4-6-16/h7-8,13,16,18H,3-6,9-12H2,1-2H3,(H,22,23)/t18-/m0/s1 |
| InChIKey | FMGOEIHKQSYUIJ-SFHVURJKSA-N |
| XLogP | 2.69 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |