C21H30N2O4 — CID 97208051
(2S)-2-(4-methoxy-3-methylphenyl)-2-[4-(piperidine-1-carbonyl)piperidin-1-yl]acetic acid (PubChem CID 97208051) has the molecular formula C21H30N2O4 and a molecular weight of 374.48 g/mol. Its IUPAC name is (2S)-2-(4-methoxy-3-methylphenyl)-2-[4-(piperidine-1-carbonyl)piperidin-1-yl]acetic acid.
| Compound Name | (2S)-2-(4-methoxy-3-methylphenyl)-2-[4-(piperidine-1-carbonyl)piperidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 97208051 |
| Molecular Formula | C21H30N2O4 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | (2S)-2-(4-methoxy-3-methylphenyl)-2-[4-(piperidine-1-carbonyl)piperidin-1-yl]acetic acid |
| SMILES | COc1ccc([C@@H](C(=O)O)N2CCC(C(=O)N3CCCCC3)CC2)cc1C |
| InChI | InChI=1S/C21H30N2O4/c1-15-14-17(6-7-18(15)27-2)19(21(25)26)22-12-8-16(9-13-22)20(24)23-10-4-3-5-11-23/h6-7,14,16,19H,3-5,8-13H2,1-2H3,(H,25,26)/t19-/m0/s1 |
| InChIKey | HMPZBHKMRZOGEG-IBGZPJMESA-N |
| XLogP | 2.85 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |