C20H27FN2O6 — CID 154913651
2-[4-(cyclobutanecarbonyl)-1,4-diazepan-1-yl]-2-(3-fluoro-4-methoxyphenyl)acetic acid;formic acid (PubChem CID 154913651) has the molecular formula C20H27FN2O6 and a molecular weight of 410.44 g/mol. Its IUPAC name is 2-[4-(cyclobutanecarbonyl)-1,4-diazepan-1-yl]-2-(3-fluoro-4-methoxyphenyl)acetic acid;formic acid.
| Compound Name | 2-[4-(cyclobutanecarbonyl)-1,4-diazepan-1-yl]-2-(3-fluoro-4-methoxyphenyl)acetic acid;formic acid |
|---|---|
| PubChem CID | 154913651 |
| Molecular Formula | C20H27FN2O6 |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | 2-[4-(cyclobutanecarbonyl)-1,4-diazepan-1-yl]-2-(3-fluoro-4-methoxyphenyl)acetic acid;formic acid |
| SMILES | COc1ccc(C(C(=O)O)N2CCCN(C(=O)C3CCC3)CC2)cc1F.O=CO |
| InChI | InChI=1S/C19H25FN2O4.CH2O2/c1-26-16-7-6-14(12-15(16)20)17(19(24)25)21-8-3-9-22(11-10-21)18(23)13-4-2-5-13;2-1-3/h6-7,12-13,17H,2-5,8-11H2,1H3,(H,24,25);1H,(H,2,3) |
| InChIKey | PFXMPUFSFUDVOJ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|