C20H28N2O5 — CID 97194298
(2R)-2-(4-cyclohexyl-3-oxopiperazin-1-yl)-2-(3,4-dimethoxyphenyl)acetic acid (PubChem CID 97194298) has the molecular formula C20H28N2O5 and a molecular weight of 376.45 g/mol. Its IUPAC name is (2R)-2-(4-cyclohexyl-3-oxopiperazin-1-yl)-2-(3,4-dimethoxyphenyl)acetic acid.
| Compound Name | (2R)-2-(4-cyclohexyl-3-oxopiperazin-1-yl)-2-(3,4-dimethoxyphenyl)acetic acid |
|---|---|
| PubChem CID | 97194298 |
| Molecular Formula | C20H28N2O5 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | (2R)-2-(4-cyclohexyl-3-oxopiperazin-1-yl)-2-(3,4-dimethoxyphenyl)acetic acid |
| SMILES | COc1ccc([C@H](C(=O)O)N2CCN(C3CCCCC3)C(=O)C2)cc1OC |
| InChI | InChI=1S/C20H28N2O5/c1-26-16-9-8-14(12-17(16)27-2)19(20(24)25)21-10-11-22(18(23)13-21)15-6-4-3-5-7-15/h8-9,12,15,19H,3-7,10-11,13H2,1-2H3,(H,24,25)/t19-/m1/s1 |
| InChIKey | DQAWSHYLRAKCRZ-LJQANCHMSA-N |
| XLogP | 2.31 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |