About (2R)-2-(3,4-dimethoxyphenyl)-2-(4-hydroxy-4-phenylpiperidin-1-yl)acetic acid
(2R)-2-(3,4-dimethoxyphenyl)-2-(4-hydroxy-4-phenylpiperidin-1-yl)acetic acid (PubChem CID 97189870) has the molecular formula C21H25NO5
and a molecular weight of 371.43 g/mol. Its IUPAC name is (2R)-2-(3,4-dimethoxyphenyl)-2-(4-hydroxy-4-phenylpiperidin-1-yl)acetic acid.
Molecular Properties
| Compound Name | (2R)-2-(3,4-dimethoxyphenyl)-2-(4-hydroxy-4-phenylpiperidin-1-yl)acetic acid |
| PubChem CID | 97189870 |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | (2R)-2-(3,4-dimethoxyphenyl)-2-(4-hydroxy-4-phenylpiperidin-1-yl)acetic acid |
| SMILES | COc1ccc([C@H](C(=O)O)N2CCC(O)(c3ccccc3)CC2)cc1OC |
| InChI | InChI=1S/C21H25NO5/c1-26-17-9-8-15(14-18(17)27-2)19(20(23)24)22-12-10-21(25,11-13-22)16-6-4-3-5-7-16/h3-9,14,19,25H,10-13H2,1-2H3,(H,23,24)/t19-/m1/s1 |
| InChIKey | IWGAVJOHECTMPJ-LJQANCHMSA-N |
| XLogP | 2.81 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2R)-2-(3,4-dimethoxyphenyl)-2-(4-hydroxy-4-phenylpiperidin-1-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(3,4-dimethoxyphenyl)-2-(4-hydroxy-4-phenylpiperidin-1-yl)acetic acid?
The IUPAC name of (2R)-2-(3,4-dimethoxyphenyl)-2-(4-hydroxy-4-phenylpiperidin-1-yl)acetic acid (CID 97189870) is (2R)-2-(3,4-dimethoxyphenyl)-2-(4-hydroxy-4-phenylpiperidin-1-yl)acetic acid.
What is the SMILES notation for (2R)-2-(3,4-dimethoxyphenyl)-2-(4-hydroxy-4-phenylpiperidin-1-yl)acetic acid?
The canonical SMILES for (2R)-2-(3,4-dimethoxyphenyl)-2-(4-hydroxy-4-phenylpiperidin-1-yl)acetic acid is COc1ccc([C@H](C(=O)O)N2CCC(O)(c3ccccc3)CC2)cc1OC.
What is the InChIKey of (2R)-2-(3,4-dimethoxyphenyl)-2-(4-hydroxy-4-phenylpiperidin-1-yl)acetic acid?
The InChIKey is IWGAVJOHECTMPJ-LJQANCHMSA-N. The full InChI is InChI=1S/C21H25NO5/c1-26-17-9-8-15(14-18(17)27-2)19(20(23)24)22-12-10-21(25,11-13-22)16-6-4-3-5-7-16/h3-9,14,19,25H,10-13H2,1-2H3,(H,23,24)/t19-/m1/s1.
What are the key properties of (2R)-2-(3,4-dimethoxyphenyl)-2-(4-hydroxy-4-phenylpiperidin-1-yl)acetic acid?
(2R)-2-(3,4-dimethoxyphenyl)-2-(4-hydroxy-4-phenylpiperidin-1-yl)acetic acid has a molecular weight of 371.43 g/mol, XLogP of 2.81, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(3,4-dimethoxyphenyl)-2-(4-hydroxy-4-phenylpiperidin-1-yl)acetic acid is sourced from PubChem (CID 97189870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).