C24H31ClN2O — CID 71386889
4-[1-chloro-2-(4-cyclohexylpiperazin-1-yl)-2-phenylethyl]phenol (PubChem CID 71386889) has the molecular formula C24H31ClN2O and a molecular weight of 398.98 g/mol. Its IUPAC name is 4-[1-chloro-2-(4-cyclohexylpiperazin-1-yl)-2-phenylethyl]phenol.
| Compound Name | 4-[1-chloro-2-(4-cyclohexylpiperazin-1-yl)-2-phenylethyl]phenol |
|---|---|
| PubChem CID | 71386889 |
| Molecular Formula | C24H31ClN2O |
| Molecular Weight | 398.98 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 4-[1-chloro-2-(4-cyclohexylpiperazin-1-yl)-2-phenylethyl]phenol |
| SMILES | Oc1ccc(C(Cl)C(c2ccccc2)N2CCN(C3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C24H31ClN2O/c25-23(19-11-13-22(28)14-12-19)24(20-7-3-1-4-8-20)27-17-15-26(16-18-27)21-9-5-2-6-10-21/h1,3-4,7-8,11-14,21,23-24,28H,2,5-6,9-10,15-18H2 |
| InChIKey | RNZAJFWKSHZZMZ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.98 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|