C24H32N2O2S — CID 15392110
1-[1-[4-(benzenesulfonyl)phenyl]ethyl]-4-cyclohexylpiperazine (PubChem CID 15392110) has the molecular formula C24H32N2O2S and a molecular weight of 412.60 g/mol. Its IUPAC name is 1-[1-[4-(benzenesulfonyl)phenyl]ethyl]-4-cyclohexylpiperazine.
| Compound Name | 1-[1-[4-(benzenesulfonyl)phenyl]ethyl]-4-cyclohexylpiperazine |
|---|---|
| PubChem CID | 15392110 |
| Molecular Formula | C24H32N2O2S |
| Molecular Weight | 412.60 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | 1-[1-[4-(benzenesulfonyl)phenyl]ethyl]-4-cyclohexylpiperazine |
| SMILES | CC(c1ccc(S(=O)(=O)c2ccccc2)cc1)N1CCN(C2CCCCC2)CC1 |
| InChI | InChI=1S/C24H32N2O2S/c1-20(25-16-18-26(19-17-25)22-8-4-2-5-9-22)21-12-14-24(15-13-21)29(27,28)23-10-6-3-7-11-23/h3,6-7,10-15,20,22H,2,4-5,8-9,16-19H2,1H3 |
| InChIKey | NHPBDFAJJFWJJX-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.60 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |