C29H40N4O4S — CID 178026985
3-amino-N-[2-[3-[4-[(1S)-1-(4-cyclohexylpiperazin-1-yl)ethyl]phenyl]sulfonylphenoxy]ethyl]prop-2-enamide (PubChem CID 178026985) has the molecular formula C29H40N4O4S and a molecular weight of 540.73 g/mol. Its IUPAC name is 3-amino-N-[2-[3-[4-[(1S)-1-(4-cyclohexylpiperazin-1-yl)ethyl]phenyl]sulfonylphenoxy]ethyl]prop-2-enamide.
| Compound Name | 3-amino-N-[2-[3-[4-[(1S)-1-(4-cyclohexylpiperazin-1-yl)ethyl]phenyl]sulfonylphenoxy]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 178026985 |
| Molecular Formula | C29H40N4O4S |
| Molecular Weight | 540.73 g/mol |
| Exact Mass | 540.28 |
| IUPAC Name | 3-amino-N-[2-[3-[4-[(1S)-1-(4-cyclohexylpiperazin-1-yl)ethyl]phenyl]sulfonylphenoxy]ethyl]prop-2-enamide |
| SMILES | C[C@@H](c1ccc(S(=O)(=O)c2cccc(OCCNC(=O)C=CN)c2)cc1)N1CCN(C2CCCCC2)CC1 |
| InChI | InChI=1S/C29H40N4O4S/c1-23(32-17-19-33(20-18-32)25-6-3-2-4-7-25)24-10-12-27(13-11-24)38(35,36)28-9-5-8-26(22-28)37-21-16-31-29(34)14-15-30/h5,8-15,22-23,25H,2-4,6-7,16-21,30H2,1H3,(H,31,34)/t23-/m0/s1 |
| InChIKey | FUBYQFKAYVUZPP-QHCPKHFHSA-N |
| XLogP | 3.50 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.73 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|