C44H52N4O6S — CID 178027236
5-[(1R)-2-[2-[3-[4-[1-(4-cyclohexylpiperazin-1-yl)ethyl]phenyl]sulfonylphenoxy]ethylamino]-1-hydroxyethyl]-8-phenylmethoxy-1H-quinolin-2-one (PubChem CID 178027236) has the molecular formula C44H52N4O6S and a molecular weight of 764.99 g/mol. Its IUPAC name is 5-[(1R)-2-[2-[3-[4-[1-(4-cyclohexylpiperazin-1-yl)ethyl]phenyl]sulfonylphenoxy]ethylamino]-1-hydroxyethyl]-8-phenylmethoxy-1H-quinolin-2-one.
| Compound Name | 5-[(1R)-2-[2-[3-[4-[1-(4-cyclohexylpiperazin-1-yl)ethyl]phenyl]sulfonylphenoxy]ethylamino]-1-hydroxyethyl]-8-phenylmethoxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 178027236 |
| Molecular Formula | C44H52N4O6S |
| Molecular Weight | 764.99 g/mol |
| Exact Mass | 764.36 |
| IUPAC Name | 5-[(1R)-2-[2-[3-[4-[1-(4-cyclohexylpiperazin-1-yl)ethyl]phenyl]sulfonylphenoxy]ethylamino]-1-hydroxyethyl]-8-phenylmethoxy-1H-quinolin-2-one |
| SMILES | CC(c1ccc(S(=O)(=O)c2cccc(OCCNC[C@H](O)c3ccc(OCc4ccccc4)c4[nH]c(=O)ccc34)c2)cc1)N1CCN(C2CCCCC2)CC1 |
| InChI | InChI=1S/C44H52N4O6S/c1-32(47-24-26-48(27-25-47)35-11-6-3-7-12-35)34-15-17-37(18-16-34)55(51,52)38-14-8-13-36(29-38)53-28-23-45-30-41(49)39-19-21-42(44-40(39)20-22-43(50)46-44)54-31-33-9-4-2-5-10-33/h2,4-5,8-10,13-22,29,32,35,41,45,49H,3,6-7,11-12,23-28,30-31H2,1H3,(H,46,50)/t32?,41-/m0/s1 |
| InChIKey | QTTPAQHQIRLKPD-BSMQZWCJSA-N |
| XLogP | 6.65 |
| TPSA | 124.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.99 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|