C30H44N2O3S — CID 178027169
6-[3-[4-[1-(4-cyclohexylpiperazin-1-yl)ethyl]phenyl]sulfinylphenoxy]hexan-1-ol (PubChem CID 178027169) has the molecular formula C30H44N2O3S and a molecular weight of 512.76 g/mol. Its IUPAC name is 6-[3-[4-[1-(4-cyclohexylpiperazin-1-yl)ethyl]phenyl]sulfinylphenoxy]hexan-1-ol.
| Compound Name | 6-[3-[4-[1-(4-cyclohexylpiperazin-1-yl)ethyl]phenyl]sulfinylphenoxy]hexan-1-ol |
|---|---|
| PubChem CID | 178027169 |
| Molecular Formula | C30H44N2O3S |
| Molecular Weight | 512.76 g/mol |
| Exact Mass | 512.31 |
| IUPAC Name | 6-[3-[4-[1-(4-cyclohexylpiperazin-1-yl)ethyl]phenyl]sulfinylphenoxy]hexan-1-ol |
| SMILES | CC(c1ccc(S(=O)c2cccc(OCCCCCCO)c2)cc1)N1CCN(C2CCCCC2)CC1 |
| InChI | InChI=1S/C30H44N2O3S/c1-25(31-18-20-32(21-19-31)27-10-5-4-6-11-27)26-14-16-29(17-15-26)36(34)30-13-9-12-28(24-30)35-23-8-3-2-7-22-33/h9,12-17,24-25,27,33H,2-8,10-11,18-23H2,1H3 |
| InChIKey | KGVJGSCTGVYJQH-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.76 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|