C17H23N3O2S — CID 124874553
methyl (2S)-2-[(3S)-3-(2-ethylimidazol-1-yl)piperidin-1-yl]-2-thiophen-3-ylacetate (PubChem CID 124874553) has the molecular formula C17H23N3O2S and a molecular weight of 333.46 g/mol. Its IUPAC name is methyl (2S)-2-[(3S)-3-(2-ethylimidazol-1-yl)piperidin-1-yl]-2-thiophen-3-ylacetate.
| Compound Name | methyl (2S)-2-[(3S)-3-(2-ethylimidazol-1-yl)piperidin-1-yl]-2-thiophen-3-ylacetate |
|---|---|
| PubChem CID | 124874553 |
| Molecular Formula | C17H23N3O2S |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | methyl (2S)-2-[(3S)-3-(2-ethylimidazol-1-yl)piperidin-1-yl]-2-thiophen-3-ylacetate |
| SMILES | CCc1nccn1[C@H]1CCCN([C@H](C(=O)OC)c2ccsc2)C1 |
| InChI | InChI=1S/C17H23N3O2S/c1-3-15-18-7-9-20(15)14-5-4-8-19(11-14)16(17(21)22-2)13-6-10-23-12-13/h6-7,9-10,12,14,16H,3-5,8,11H2,1-2H3/t14-,16-/m0/s1 |
| InChIKey | RKYLEWBNGAJUQG-HOCLYGCPSA-N |
| XLogP | 3.06 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |