C14H23N3O3S — CID 95343440
1-[(3R)-3-(2-ethylimidazol-1-yl)piperidin-1-yl]-2-ethylsulfonylethanone (PubChem CID 95343440) has the molecular formula C14H23N3O3S and a molecular weight of 313.42 g/mol. Its IUPAC name is 1-[(3R)-3-(2-ethylimidazol-1-yl)piperidin-1-yl]-2-ethylsulfonylethanone.
| Compound Name | 1-[(3R)-3-(2-ethylimidazol-1-yl)piperidin-1-yl]-2-ethylsulfonylethanone |
|---|---|
| PubChem CID | 95343440 |
| Molecular Formula | C14H23N3O3S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 1-[(3R)-3-(2-ethylimidazol-1-yl)piperidin-1-yl]-2-ethylsulfonylethanone |
| SMILES | CCc1nccn1[C@@H]1CCCN(C(=O)CS(=O)(=O)CC)C1 |
| InChI | InChI=1S/C14H23N3O3S/c1-3-13-15-7-9-17(13)12-6-5-8-16(10-12)14(18)11-21(19,20)4-2/h7,9,12H,3-6,8,10-11H2,1-2H3/t12-/m1/s1 |
| InChIKey | FDGMZWBDVSRZDX-GFCCVEGCSA-N |
| XLogP | 1.04 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |