C15H25N3O3S — CID 95341954
1-[(3R)-3-(2-ethylimidazol-1-yl)piperidin-1-yl]-2-propylsulfonylethanone (PubChem CID 95341954) has the molecular formula C15H25N3O3S and a molecular weight of 327.45 g/mol. Its IUPAC name is 1-[(3R)-3-(2-ethylimidazol-1-yl)piperidin-1-yl]-2-propylsulfonylethanone.
| Compound Name | 1-[(3R)-3-(2-ethylimidazol-1-yl)piperidin-1-yl]-2-propylsulfonylethanone |
|---|---|
| PubChem CID | 95341954 |
| Molecular Formula | C15H25N3O3S |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 1-[(3R)-3-(2-ethylimidazol-1-yl)piperidin-1-yl]-2-propylsulfonylethanone |
| SMILES | CCCS(=O)(=O)CC(=O)N1CCC[C@@H](n2ccnc2CC)C1 |
| InChI | InChI=1S/C15H25N3O3S/c1-3-10-22(20,21)12-15(19)17-8-5-6-13(11-17)18-9-7-16-14(18)4-2/h7,9,13H,3-6,8,10-12H2,1-2H3/t13-/m1/s1 |
| InChIKey | SVOFEFAIZRTPGZ-CYBMUJFWSA-N |
| XLogP | 1.43 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |