C14H20F2N4 — CID 81293736
4-[3-(dimethylamino)piperidin-1-yl]-3,5-difluorobenzenecarboximidamide (PubChem CID 81293736) has the molecular formula C14H20F2N4 and a molecular weight of 282.34 g/mol. Its IUPAC name is 4-[3-(dimethylamino)piperidin-1-yl]-3,5-difluorobenzenecarboximidamide.
| Compound Name | 4-[3-(dimethylamino)piperidin-1-yl]-3,5-difluorobenzenecarboximidamide |
|---|---|
| PubChem CID | 81293736 |
| Molecular Formula | C14H20F2N4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 4-[3-(dimethylamino)piperidin-1-yl]-3,5-difluorobenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cc(F)c(N2CCCC(N(C)C)C2)c(F)c1 |
| InChI | InChI=1S/C14H20F2N4/c1-19(2)10-4-3-5-20(8-10)13-11(15)6-9(14(17)18)7-12(13)16/h6-7,10H,3-5,8H2,1-2H3,(H3,17,18) |
| InChIKey | XQXWOMNELKPCOP-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 56.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|