C17H25N3O2 — CID 142849611
methanol;5-[(4-methyl-1,4-diazepan-1-yl)methyl]quinolin-8-ol (PubChem CID 142849611) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is methanol;5-[(4-methyl-1,4-diazepan-1-yl)methyl]quinolin-8-ol.
| Compound Name | methanol;5-[(4-methyl-1,4-diazepan-1-yl)methyl]quinolin-8-ol |
|---|---|
| PubChem CID | 142849611 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | methanol;5-[(4-methyl-1,4-diazepan-1-yl)methyl]quinolin-8-ol |
| SMILES | CN1CCCN(Cc2ccc(O)c3ncccc23)CC1.CO |
| InChI | InChI=1S/C16H21N3O.CH4O/c1-18-8-3-9-19(11-10-18)12-13-5-6-15(20)16-14(13)4-2-7-17-16;1-2/h2,4-7,20H,3,8-12H2,1H3;2H,1H3 |
| InChIKey | IIASXXGVHYOXSN-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 59.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |