C14H18BrCl2N — CID 102637231
2-bromo-N-[(2,6-dichlorophenyl)methyl]-N-methylcyclohexan-1-amine (PubChem CID 102637231) has the molecular formula C14H18BrCl2N and a molecular weight of 351.12 g/mol. Its IUPAC name is 2-bromo-N-[(2,6-dichlorophenyl)methyl]-N-methylcyclohexan-1-amine.
| Compound Name | 2-bromo-N-[(2,6-dichlorophenyl)methyl]-N-methylcyclohexan-1-amine |
|---|---|
| PubChem CID | 102637231 |
| Molecular Formula | C14H18BrCl2N |
| Molecular Weight | 351.12 g/mol |
| Exact Mass | 349.00 |
| IUPAC Name | 2-bromo-N-[(2,6-dichlorophenyl)methyl]-N-methylcyclohexan-1-amine |
| SMILES | CN(Cc1c(Cl)cccc1Cl)C1CCCCC1Br |
| InChI | InChI=1S/C14H18BrCl2N/c1-18(14-8-3-2-5-11(14)15)9-10-12(16)6-4-7-13(10)17/h4,6-7,11,14H,2-3,5,8-9H2,1H3 |
| InChIKey | RDTLDEWXKLHJBP-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.12 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|