C14H18BrF2N — CID 102637204
2-bromo-N-[(2,6-difluorophenyl)methyl]-N-methylcyclohexan-1-amine (PubChem CID 102637204) has the molecular formula C14H18BrF2N and a molecular weight of 318.20 g/mol. Its IUPAC name is 2-bromo-N-[(2,6-difluorophenyl)methyl]-N-methylcyclohexan-1-amine.
| Compound Name | 2-bromo-N-[(2,6-difluorophenyl)methyl]-N-methylcyclohexan-1-amine |
|---|---|
| PubChem CID | 102637204 |
| Molecular Formula | C14H18BrF2N |
| Molecular Weight | 318.20 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 2-bromo-N-[(2,6-difluorophenyl)methyl]-N-methylcyclohexan-1-amine |
| SMILES | CN(Cc1c(F)cccc1F)C1CCCCC1Br |
| InChI | InChI=1S/C14H18BrF2N/c1-18(14-8-3-2-5-11(14)15)9-10-12(16)6-4-7-13(10)17/h4,6-7,11,14H,2-3,5,8-9H2,1H3 |
| InChIKey | DUZFNGLQTZQQMD-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.20 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|