C15H19BrFNO2 — CID 102638292
N-(2-bromocyclohexyl)-2-fluoro-6-methoxy-N-methylbenzamide (PubChem CID 102638292) has the molecular formula C15H19BrFNO2 and a molecular weight of 344.22 g/mol. Its IUPAC name is N-(2-bromocyclohexyl)-2-fluoro-6-methoxy-N-methylbenzamide.
| Compound Name | N-(2-bromocyclohexyl)-2-fluoro-6-methoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 102638292 |
| Molecular Formula | C15H19BrFNO2 |
| Molecular Weight | 344.22 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | N-(2-bromocyclohexyl)-2-fluoro-6-methoxy-N-methylbenzamide |
| SMILES | COc1cccc(F)c1C(=O)N(C)C1CCCCC1Br |
| InChI | InChI=1S/C15H19BrFNO2/c1-18(12-8-4-3-6-10(12)16)15(19)14-11(17)7-5-9-13(14)20-2/h5,7,9-10,12H,3-4,6,8H2,1-2H3 |
| InChIKey | XOYDHHNMGUMFFX-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.22 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|