C14H15BrF3NO2 — CID 102638299
N-(2-bromocyclohexyl)-2,4,5-trifluoro-3-hydroxy-N-methylbenzamide (PubChem CID 102638299) has the molecular formula C14H15BrF3NO2 and a molecular weight of 366.18 g/mol. Its IUPAC name is N-(2-bromocyclohexyl)-2,4,5-trifluoro-3-hydroxy-N-methylbenzamide.
| Compound Name | N-(2-bromocyclohexyl)-2,4,5-trifluoro-3-hydroxy-N-methylbenzamide |
|---|---|
| PubChem CID | 102638299 |
| Molecular Formula | C14H15BrF3NO2 |
| Molecular Weight | 366.18 g/mol |
| Exact Mass | 365.02 |
| IUPAC Name | N-(2-bromocyclohexyl)-2,4,5-trifluoro-3-hydroxy-N-methylbenzamide |
| SMILES | CN(C(=O)c1cc(F)c(F)c(O)c1F)C1CCCCC1Br |
| InChI | InChI=1S/C14H15BrF3NO2/c1-19(10-5-3-2-4-8(10)15)14(21)7-6-9(16)12(18)13(20)11(7)17/h6,8,10,20H,2-5H2,1H3 |
| InChIKey | VAVQEJKXOXECEM-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.18 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|