C17H22NO4+ — CID 6920052
8-[[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]methyl]-7-hydroxy-4-methylchromen-2-one (PubChem CID 6920052) has the molecular formula C17H22NO4+ and a molecular weight of 304.37 g/mol. Its IUPAC name is 8-[[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]methyl]-7-hydroxy-4-methylchromen-2-one.
| Compound Name | 8-[[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]methyl]-7-hydroxy-4-methylchromen-2-one |
|---|---|
| PubChem CID | 6920052 |
| Molecular Formula | C17H22NO4+ |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 8-[[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]methyl]-7-hydroxy-4-methylchromen-2-one |
| SMILES | Cc1cc(=O)oc2c(C[NH+]3C[C@@H](C)O[C@H](C)C3)c(O)ccc12 |
| InChI | InChI=1S/C17H21NO4/c1-10-6-16(20)22-17-13(10)4-5-15(19)14(17)9-18-7-11(2)21-12(3)8-18/h4-6,11-12,19H,7-9H2,1-3H3/p+1/t11-,12-/m1/s1 |
| InChIKey | WBYAFENTWYUJID-VXGBXAGGSA-O |
| XLogP | 1.00 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|