C20H17NO7 — CID 11625144
ethyl 2-[6-[(3,5-dihydroxyphenyl)methylideneamino]-7-hydroxy-2-oxochromen-4-yl]acetate (PubChem CID 11625144) has the molecular formula C20H17NO7 and a molecular weight of 383.36 g/mol. Its IUPAC name is ethyl 2-[6-[(3,5-dihydroxyphenyl)methylideneamino]-7-hydroxy-2-oxochromen-4-yl]acetate.
| Compound Name | ethyl 2-[6-[(3,5-dihydroxyphenyl)methylideneamino]-7-hydroxy-2-oxochromen-4-yl]acetate |
|---|---|
| PubChem CID | 11625144 |
| Molecular Formula | C20H17NO7 |
| Molecular Weight | 383.36 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | ethyl 2-[6-[(3,5-dihydroxyphenyl)methylideneamino]-7-hydroxy-2-oxochromen-4-yl]acetate |
| SMILES | CCOC(=O)Cc1cc(=O)oc2cc(O)c(/N=C/c3cc(O)cc(O)c3)cc12 |
| InChI | InChI=1S/C20H17NO7/c1-2-27-19(25)5-12-6-20(26)28-18-9-17(24)16(8-15(12)18)21-10-11-3-13(22)7-14(23)4-11/h3-4,6-10,22-24H,2,5H2,1H3/b21-10+ |
| InChIKey | GKDPJWXCFYZZIK-UFFVCSGVSA-N |
| XLogP | 2.77 |
| TPSA | 129.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|