C13H12O6 — CID 54704726
4-hydroxy-6-(4-hydroxy-3,5-dimethoxyphenyl)pyran-2-one (PubChem CID 54704726) has the molecular formula C13H12O6 and a molecular weight of 264.23 g/mol. Its IUPAC name is 4-hydroxy-6-(4-hydroxy-3,5-dimethoxyphenyl)pyran-2-one.
| Compound Name | 4-hydroxy-6-(4-hydroxy-3,5-dimethoxyphenyl)pyran-2-one |
|---|---|
| PubChem CID | 54704726 |
| Molecular Formula | C13H12O6 |
| Molecular Weight | 264.23 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 4-hydroxy-6-(4-hydroxy-3,5-dimethoxyphenyl)pyran-2-one |
| SMILES | COc1cc(-c2cc(O)cc(=O)o2)cc(OC)c1O |
| InChI | InChI=1S/C13H12O6/c1-17-10-3-7(4-11(18-2)13(10)16)9-5-8(14)6-12(15)19-9/h3-6,14,16H,1-2H3 |
| InChIKey | OAMHQEBGWAPGBN-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.23 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |