C14H15NO7 — CID 23335105
[2,3-diacetyloxy-5-(methylcarbamoyl)phenyl] acetate (PubChem CID 23335105) has the molecular formula C14H15NO7 and a molecular weight of 309.27 g/mol. Its IUPAC name is [2,3-diacetyloxy-5-(methylcarbamoyl)phenyl] acetate.
| Compound Name | [2,3-diacetyloxy-5-(methylcarbamoyl)phenyl] acetate |
|---|---|
| PubChem CID | 23335105 |
| Molecular Formula | C14H15NO7 |
| Molecular Weight | 309.27 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | [2,3-diacetyloxy-5-(methylcarbamoyl)phenyl] acetate |
| SMILES | CNC(=O)c1cc(OC(C)=O)c(OC(C)=O)c(OC(C)=O)c1 |
| InChI | InChI=1S/C14H15NO7/c1-7(16)20-11-5-10(14(19)15-4)6-12(21-8(2)17)13(11)22-9(3)18/h5-6H,1-4H3,(H,15,19) |
| InChIKey | BFJSMSPRRMOLIE-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.27 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|