C21H22N2O7 — CID 2326725
[2,3-diacetyloxy-5-[[4-(dimethylamino)phenyl]carbamoyl]phenyl] acetate (PubChem CID 2326725) has the molecular formula C21H22N2O7 and a molecular weight of 414.41 g/mol. Its IUPAC name is [2,3-diacetyloxy-5-[[4-(dimethylamino)phenyl]carbamoyl]phenyl] acetate.
| Compound Name | [2,3-diacetyloxy-5-[[4-(dimethylamino)phenyl]carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 2326725 |
| Molecular Formula | C21H22N2O7 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | [2,3-diacetyloxy-5-[[4-(dimethylamino)phenyl]carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cc(C(=O)Nc2ccc(N(C)C)cc2)cc(OC(C)=O)c1OC(C)=O |
| InChI | InChI=1S/C21H22N2O7/c1-12(24)28-18-10-15(11-19(29-13(2)25)20(18)30-14(3)26)21(27)22-16-6-8-17(9-7-16)23(4)5/h6-11H,1-5H3,(H,22,27) |
| InChIKey | SXHFVZPTCRFDDQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|