C26H24N2O9S — CID 45270167
[2,3-diacetyloxy-5-[[4-[(2-methylphenyl)sulfamoyl]phenyl]carbamoyl]phenyl] acetate (PubChem CID 45270167) has the molecular formula C26H24N2O9S and a molecular weight of 540.55 g/mol. Its IUPAC name is [2,3-diacetyloxy-5-[[4-[(2-methylphenyl)sulfamoyl]phenyl]carbamoyl]phenyl] acetate.
| Compound Name | [2,3-diacetyloxy-5-[[4-[(2-methylphenyl)sulfamoyl]phenyl]carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 45270167 |
| Molecular Formula | C26H24N2O9S |
| Molecular Weight | 540.55 g/mol |
| Exact Mass | 540.12 |
| IUPAC Name | [2,3-diacetyloxy-5-[[4-[(2-methylphenyl)sulfamoyl]phenyl]carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cc(C(=O)Nc2ccc(S(=O)(=O)Nc3ccccc3C)cc2)cc(OC(C)=O)c1OC(C)=O |
| InChI | InChI=1S/C26H24N2O9S/c1-15-7-5-6-8-22(15)28-38(33,34)21-11-9-20(10-12-21)27-26(32)19-13-23(35-16(2)29)25(37-18(4)31)24(14-19)36-17(3)30/h5-14,28H,1-4H3,(H,27,32) |
| InChIKey | HMJWHHZNWNCONG-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 154.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.55 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|