C27H24N2O10S — CID 154791697
[2,3-diacetyloxy-5-[[4-[(3-acetylphenyl)sulfamoyl]phenyl]carbamoyl]phenyl] acetate (PubChem CID 154791697) has the molecular formula C27H24N2O10S and a molecular weight of 568.56 g/mol. Its IUPAC name is [2,3-diacetyloxy-5-[[4-[(3-acetylphenyl)sulfamoyl]phenyl]carbamoyl]phenyl] acetate.
| Compound Name | [2,3-diacetyloxy-5-[[4-[(3-acetylphenyl)sulfamoyl]phenyl]carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 154791697 |
| Molecular Formula | C27H24N2O10S |
| Molecular Weight | 568.56 g/mol |
| Exact Mass | 568.12 |
| IUPAC Name | [2,3-diacetyloxy-5-[[4-[(3-acetylphenyl)sulfamoyl]phenyl]carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cc(C(=O)Nc2ccc(S(=O)(=O)Nc3cccc(C(C)=O)c3)cc2)cc(OC(C)=O)c1OC(C)=O |
| InChI | InChI=1S/C27H24N2O10S/c1-15(30)19-6-5-7-22(12-19)29-40(35,36)23-10-8-21(9-11-23)28-27(34)20-13-24(37-16(2)31)26(39-18(4)33)25(14-20)38-17(3)32/h5-14,29H,1-4H3,(H,28,34) |
| InChIKey | JESHIKJOXTWPHW-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 171.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.56 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|