C15H11Cl2NO4 — CID 17361787
[2,6-dichloro-4-[(4-hydroxyphenyl)carbamoyl]phenyl] acetate (PubChem CID 17361787) has the molecular formula C15H11Cl2NO4 and a molecular weight of 340.16 g/mol. Its IUPAC name is [2,6-dichloro-4-[(4-hydroxyphenyl)carbamoyl]phenyl] acetate.
| Compound Name | [2,6-dichloro-4-[(4-hydroxyphenyl)carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 17361787 |
| Molecular Formula | C15H11Cl2NO4 |
| Molecular Weight | 340.16 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | [2,6-dichloro-4-[(4-hydroxyphenyl)carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1c(Cl)cc(C(=O)Nc2ccc(O)cc2)cc1Cl |
| InChI | InChI=1S/C15H11Cl2NO4/c1-8(19)22-14-12(16)6-9(7-13(14)17)15(21)18-10-2-4-11(20)5-3-10/h2-7,20H,1H3,(H,18,21) |
| InChIKey | GJNONOHJSNAACE-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.16 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|