C15H13Cl2N3O3 — CID 33153788
N-[4-(carbamoylamino)phenyl]-3,5-dichloro-4-methoxybenzamide (PubChem CID 33153788) has the molecular formula C15H13Cl2N3O3 and a molecular weight of 354.19 g/mol. Its IUPAC name is N-[4-(carbamoylamino)phenyl]-3,5-dichloro-4-methoxybenzamide.
| Compound Name | N-[4-(carbamoylamino)phenyl]-3,5-dichloro-4-methoxybenzamide |
|---|---|
| PubChem CID | 33153788 |
| Molecular Formula | C15H13Cl2N3O3 |
| Molecular Weight | 354.19 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | N-[4-(carbamoylamino)phenyl]-3,5-dichloro-4-methoxybenzamide |
| SMILES | COc1c(Cl)cc(C(=O)Nc2ccc(NC(N)=O)cc2)cc1Cl |
| InChI | InChI=1S/C15H13Cl2N3O3/c1-23-13-11(16)6-8(7-12(13)17)14(21)19-9-2-4-10(5-3-9)20-15(18)22/h2-7H,1H3,(H,19,21)(H3,18,20,22) |
| InChIKey | XRPVTAMJOJHHNA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.19 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |