C9H15O6P — CID 174603816
phosphoric acid;3-propylbenzene-1,2-diol (PubChem CID 174603816) has the molecular formula C9H15O6P and a molecular weight of 250.19 g/mol. Its IUPAC name is phosphoric acid;3-propylbenzene-1,2-diol.
| Compound Name | phosphoric acid;3-propylbenzene-1,2-diol |
|---|---|
| PubChem CID | 174603816 |
| Molecular Formula | C9H15O6P |
| Molecular Weight | 250.19 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | phosphoric acid;3-propylbenzene-1,2-diol |
| SMILES | CCCc1cccc(O)c1O.O=P(O)(O)O |
| InChI | InChI=1S/C9H12O2.H3O4P/c1-2-4-7-5-3-6-8(10)9(7)11;1-5(2,3)4/h3,5-6,10-11H,2,4H2,1H3;(H3,1,2,3,4) |
| InChIKey | NQNYRSVNNGLJPW-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.19 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|