C17H25BrF2O — CID 152671915
1-(bromomethyl)-2-(10,10-difluorodecoxy)benzene (PubChem CID 152671915) has the molecular formula C17H25BrF2O and a molecular weight of 363.29 g/mol. Its IUPAC name is 1-(bromomethyl)-2-(10,10-difluorodecoxy)benzene.
| Compound Name | 1-(bromomethyl)-2-(10,10-difluorodecoxy)benzene |
|---|---|
| PubChem CID | 152671915 |
| Molecular Formula | C17H25BrF2O |
| Molecular Weight | 363.29 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 1-(bromomethyl)-2-(10,10-difluorodecoxy)benzene |
| SMILES | FC(F)CCCCCCCCCOc1ccccc1CBr |
| InChI | InChI=1S/C17H25BrF2O/c18-14-15-10-7-8-11-16(15)21-13-9-5-3-1-2-4-6-12-17(19)20/h7-8,10-11,17H,1-6,9,12-14H2 |
| InChIKey | ZLSKFEYXXOYREL-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.29 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|