C18H25F2NO — CID 151705532
2-[2-(10,10-difluorodecoxy)phenyl]acetonitrile (PubChem CID 151705532) has the molecular formula C18H25F2NO and a molecular weight of 309.40 g/mol. Its IUPAC name is 2-[2-(10,10-difluorodecoxy)phenyl]acetonitrile.
| Compound Name | 2-[2-(10,10-difluorodecoxy)phenyl]acetonitrile |
|---|---|
| PubChem CID | 151705532 |
| Molecular Formula | C18H25F2NO |
| Molecular Weight | 309.40 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | 2-[2-(10,10-difluorodecoxy)phenyl]acetonitrile |
| SMILES | N#CCc1ccccc1OCCCCCCCCCC(F)F |
| InChI | InChI=1S/C18H25F2NO/c19-18(20)12-6-4-2-1-3-5-9-15-22-17-11-8-7-10-16(17)13-14-21/h7-8,10-11,18H,1-6,9,12-13,15H2 |
| InChIKey | RFMNZVPJUAXFHS-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.40 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|