About 1-(bromomethyl)-2-(4-phenoxybutoxy)benzene;triphenylphosphane
1-(bromomethyl)-2-(4-phenoxybutoxy)benzene;triphenylphosphane (PubChem CID 88620751) has the molecular formula C35H34BrO2P
and a molecular weight of 597.53 g/mol. Its IUPAC name is 1-(bromomethyl)-2-(4-phenoxybutoxy)benzene;triphenylphosphane.
Molecular Properties
| Compound Name | 1-(bromomethyl)-2-(4-phenoxybutoxy)benzene;triphenylphosphane |
| PubChem CID | 88620751 |
| Molecular Formula | C35H34BrO2P |
| Molecular Weight | 597.53 g/mol |
| Exact Mass | 596.15 |
| IUPAC Name | 1-(bromomethyl)-2-(4-phenoxybutoxy)benzene;triphenylphosphane |
| SMILES | BrCc1ccccc1OCCCCOc1ccccc1.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C17H19BrO2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;18-14-15-8-4-5-11-17(15)20-13-7-6-12-19-16-9-2-1-3-10-16/h1-15H;1-5,8-11H,6-7,12-14H2 |
| InChIKey | UQYPQLHSIKXISE-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 597.53 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-(bromomethyl)-2-(4-phenoxybutoxy)benzene;triphenylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(bromomethyl)-2-(4-phenoxybutoxy)benzene;triphenylphosphane?
The IUPAC name of 1-(bromomethyl)-2-(4-phenoxybutoxy)benzene;triphenylphosphane (CID 88620751) is 1-(bromomethyl)-2-(4-phenoxybutoxy)benzene;triphenylphosphane.
What is the SMILES notation for 1-(bromomethyl)-2-(4-phenoxybutoxy)benzene;triphenylphosphane?
The canonical SMILES for 1-(bromomethyl)-2-(4-phenoxybutoxy)benzene;triphenylphosphane is BrCc1ccccc1OCCCCOc1ccccc1.c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 1-(bromomethyl)-2-(4-phenoxybutoxy)benzene;triphenylphosphane?
The InChIKey is UQYPQLHSIKXISE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15P.C17H19BrO2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;18-14-15-8-4-5-11-17(15)20-13-7-6-12-19-16-9-2-1-3-10-16/h1-15H;1-5,8-11H,6-7,12-14H2.
What are the key properties of 1-(bromomethyl)-2-(4-phenoxybutoxy)benzene;triphenylphosphane?
1-(bromomethyl)-2-(4-phenoxybutoxy)benzene;triphenylphosphane has a molecular weight of 597.53 g/mol, XLogP of 8.26, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(bromomethyl)-2-(4-phenoxybutoxy)benzene;triphenylphosphane is sourced from PubChem (CID 88620751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).