C10H10ClF3N2O — CID 61381204
6-chloro-N-methyl-N-(3,3,3-trifluoropropyl)pyridine-3-carboxamide (PubChem CID 61381204) has the molecular formula C10H10ClF3N2O and a molecular weight of 266.65 g/mol. Its IUPAC name is 6-chloro-N-methyl-N-(3,3,3-trifluoropropyl)pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-methyl-N-(3,3,3-trifluoropropyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 61381204 |
| Molecular Formula | C10H10ClF3N2O |
| Molecular Weight | 266.65 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | 6-chloro-N-methyl-N-(3,3,3-trifluoropropyl)pyridine-3-carboxamide |
| SMILES | CN(CCC(F)(F)F)C(=O)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C10H10ClF3N2O/c1-16(5-4-10(12,13)14)9(17)7-2-3-8(11)15-6-7/h2-3,6H,4-5H2,1H3 |
| InChIKey | JFGUNJIQYUWIHL-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.65 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|