C12H13F4NO — CID 86833486
3-fluoro-N,4-dimethyl-N-(3,3,3-trifluoropropyl)benzamide (PubChem CID 86833486) has the molecular formula C12H13F4NO and a molecular weight of 263.23 g/mol. Its IUPAC name is 3-fluoro-N,4-dimethyl-N-(3,3,3-trifluoropropyl)benzamide.
| Compound Name | 3-fluoro-N,4-dimethyl-N-(3,3,3-trifluoropropyl)benzamide |
|---|---|
| PubChem CID | 86833486 |
| Molecular Formula | C12H13F4NO |
| Molecular Weight | 263.23 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 3-fluoro-N,4-dimethyl-N-(3,3,3-trifluoropropyl)benzamide |
| SMILES | Cc1ccc(C(=O)N(C)CCC(F)(F)F)cc1F |
| InChI | InChI=1S/C12H13F4NO/c1-8-3-4-9(7-10(8)13)11(18)17(2)6-5-12(14,15)16/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | VXYBJBZWEBJJAL-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.23 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |