C13H18FNO2 — CID 111695800
3-fluoro-N-(3-hydroxybutyl)-N,4-dimethylbenzamide (PubChem CID 111695800) has the molecular formula C13H18FNO2 and a molecular weight of 239.29 g/mol. Its IUPAC name is 3-fluoro-N-(3-hydroxybutyl)-N,4-dimethylbenzamide.
| Compound Name | 3-fluoro-N-(3-hydroxybutyl)-N,4-dimethylbenzamide |
|---|---|
| PubChem CID | 111695800 |
| Molecular Formula | C13H18FNO2 |
| Molecular Weight | 239.29 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 3-fluoro-N-(3-hydroxybutyl)-N,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)N(C)CCC(C)O)cc1F |
| InChI | InChI=1S/C13H18FNO2/c1-9-4-5-11(8-12(9)14)13(17)15(3)7-6-10(2)16/h4-5,8,10,16H,6-7H2,1-3H3 |
| InChIKey | DAQQBTCMKXSQBD-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.29 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |