C10H8ClF3N2O3 — CID 79258051
2-[(6-chloropyridine-3-carbonyl)-(2,2,2-trifluoroethyl)amino]acetic acid (PubChem CID 79258051) has the molecular formula C10H8ClF3N2O3 and a molecular weight of 296.63 g/mol. Its IUPAC name is 2-[(6-chloropyridine-3-carbonyl)-(2,2,2-trifluoroethyl)amino]acetic acid.
| Compound Name | 2-[(6-chloropyridine-3-carbonyl)-(2,2,2-trifluoroethyl)amino]acetic acid |
|---|---|
| PubChem CID | 79258051 |
| Molecular Formula | C10H8ClF3N2O3 |
| Molecular Weight | 296.63 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | 2-[(6-chloropyridine-3-carbonyl)-(2,2,2-trifluoroethyl)amino]acetic acid |
| SMILES | O=C(O)CN(CC(F)(F)F)C(=O)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C10H8ClF3N2O3/c11-7-2-1-6(3-15-7)9(19)16(4-8(17)18)5-10(12,13)14/h1-3H,4-5H2,(H,17,18) |
| InChIKey | ZXXUOUJBTVAPIV-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.63 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|