C11H10BrF3N2O3 — CID 79258006
2-[(4-amino-3-bromobenzoyl)-(2,2,2-trifluoroethyl)amino]acetic acid (PubChem CID 79258006) has the molecular formula C11H10BrF3N2O3 and a molecular weight of 355.11 g/mol. Its IUPAC name is 2-[(4-amino-3-bromobenzoyl)-(2,2,2-trifluoroethyl)amino]acetic acid.
| Compound Name | 2-[(4-amino-3-bromobenzoyl)-(2,2,2-trifluoroethyl)amino]acetic acid |
|---|---|
| PubChem CID | 79258006 |
| Molecular Formula | C11H10BrF3N2O3 |
| Molecular Weight | 355.11 g/mol |
| Exact Mass | 353.98 |
| IUPAC Name | 2-[(4-amino-3-bromobenzoyl)-(2,2,2-trifluoroethyl)amino]acetic acid |
| SMILES | Nc1ccc(C(=O)N(CC(=O)O)CC(F)(F)F)cc1Br |
| InChI | InChI=1S/C11H10BrF3N2O3/c12-7-3-6(1-2-8(7)16)10(20)17(4-9(18)19)5-11(13,14)15/h1-3H,4-5,16H2,(H,18,19) |
| InChIKey | YKMCXPTXKXHERC-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.11 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|